C16H21FN2O8 — CID 177261190
[3-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]methyl cyclopentanecarboxylate (PubChem CID 177261190) has the molecular formula C16H21FN2O8 and a molecular weight of 388.35 g/mol. Its IUPAC name is [3-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]methyl cyclopentanecarboxylate.
| Compound Name | [3-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]methyl cyclopentanecarboxylate |
|---|---|
| PubChem CID | 177261190 |
| Molecular Formula | C16H21FN2O8 |
| Molecular Weight | 388.35 g/mol |
| Exact Mass | 388.13 |
| IUPAC Name | [3-[(2R,3R,4S,5S)-5-fluoro-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,6-dioxopyrimidin-1-yl]methyl cyclopentanecarboxylate |
| SMILES | O=C(OCn1c(=O)ccn([C@@H]2O[C@](F)(CO)[C@@H](O)[C@H]2O)c1=O)C1CCCC1 |
| InChI | InChI=1S/C16H21FN2O8/c17-16(7-20)12(23)11(22)13(27-16)18-6-5-10(21)19(15(18)25)8-26-14(24)9-3-1-2-4-9/h5-6,9,11-13,20,22-23H,1-4,7-8H2/t11-,12+,13-,16-/m1/s1 |
| InChIKey | GDWPVJUEHMYPPC-OQMKEHIESA-N |
| XLogP | -1.39 |
| TPSA | 140.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.35 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |