About CID 58226914
CID 58226914 (PubChem CID 58226914) has the molecular formula C8H14BNO4
and a molecular weight of 199.01 g/mol.
Molecular Properties
| Compound Name | CID 58226914 |
| PubChem CID | 58226914 |
| Molecular Formula | C8H14BNO4 |
| Molecular Weight | 199.01 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1OC(CO)[C@](C)(C(=O)NC)[C@H]1O |
| InChI | InChI=1S/C8H14BNO4/c1-8(7(13)10-2)4(3-11)14-6(9)5(8)12/h4-6,11-12H,3H2,1-2H3,(H,10,13)/t4?,5-,6+,8-/m0/s1 |
| InChIKey | JSDJFEHFNMDEEK-FRBAZZNPSA-N |
| XLogP | -2.01 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.01 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 58226914 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 58226914?
The IUPAC name of CID 58226914 (CID 58226914) is not available.
What is the SMILES notation for CID 58226914?
The canonical SMILES for CID 58226914 is [B][C@@H]1OC(CO)[C@](C)(C(=O)NC)[C@H]1O.
What is the InChIKey of CID 58226914?
The InChIKey is JSDJFEHFNMDEEK-FRBAZZNPSA-N. The full InChI is InChI=1S/C8H14BNO4/c1-8(7(13)10-2)4(3-11)14-6(9)5(8)12/h4-6,11-12H,3H2,1-2H3,(H,10,13)/t4?,5-,6+,8-/m0/s1.
What are the key properties of CID 58226914?
CID 58226914 has a molecular weight of 199.01 g/mol, XLogP of -2.01, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 58226914 is sourced from PubChem (CID 58226914), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).