C8H14BNO4 — CID 58226914
CID 58226914 (PubChem CID 58226914) has the molecular formula C8H14BNO4 and a molecular weight of 199.01 g/mol.
| Compound Name | CID 58226914 |
|---|---|
| PubChem CID | 58226914 |
| Molecular Formula | C8H14BNO4 |
| Molecular Weight | 199.01 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | — |
| SMILES | [B][C@@H]1OC(CO)[C@](C)(C(=O)NC)[C@H]1O |
| InChI | InChI=1S/C8H14BNO4/c1-8(7(13)10-2)4(3-11)14-6(9)5(8)12/h4-6,11-12H,3H2,1-2H3,(H,10,13)/t4?,5-,6+,8-/m0/s1 |
| InChIKey | JSDJFEHFNMDEEK-FRBAZZNPSA-N |
| XLogP | -2.01 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.01 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|