C21H30N2O3S — CID 158506664
N-(1-adamantylmethyl)-N-[[4-(2-aminoacetyl)phenyl]methyl]methanesulfonamide (PubChem CID 158506664) has the molecular formula C21H30N2O3S and a molecular weight of 390.55 g/mol. Its IUPAC name is N-(1-adamantylmethyl)-N-[[4-(2-aminoacetyl)phenyl]methyl]methanesulfonamide.
| Compound Name | N-(1-adamantylmethyl)-N-[[4-(2-aminoacetyl)phenyl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 158506664 |
| Molecular Formula | C21H30N2O3S |
| Molecular Weight | 390.55 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | N-(1-adamantylmethyl)-N-[[4-(2-aminoacetyl)phenyl]methyl]methanesulfonamide |
| SMILES | CS(=O)(=O)N(Cc1ccc(C(=O)CN)cc1)CC12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C21H30N2O3S/c1-27(25,26)23(13-15-2-4-19(5-3-15)20(24)12-22)14-21-9-16-6-17(10-21)8-18(7-16)11-21/h2-5,16-18H,6-14,22H2,1H3 |
| InChIKey | PHFFQVPDKOJCFR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 80.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.55 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |