C26H27N3O5 — CID 158507745
N-[(2S)-4-[(3aR,6aR)-5-cyano-1,3-dioxo-3a,4,6,6a-tetrahydrocyclopenta[c]pyrrol-5-yl]-1-cyclopropyl-3-oxobutan-2-yl]-4-methoxy-1H-indene-2-carboxamide (PubChem CID 158507745) has the molecular formula C26H27N3O5 and a molecular weight of 461.52 g/mol. Its IUPAC name is N-[(2S)-4-[(3aR,6aR)-5-cyano-1,3-dioxo-3a,4,6,6a-tetrahydrocyclopenta[c]pyrrol-5-yl]-1-cyclopropyl-3-oxobutan-2-yl]-4-methoxy-1H-indene-2-carboxamide.
| Compound Name | N-[(2S)-4-[(3aR,6aR)-5-cyano-1,3-dioxo-3a,4,6,6a-tetrahydrocyclopenta[c]pyrrol-5-yl]-1-cyclopropyl-3-oxobutan-2-yl]-4-methoxy-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 158507745 |
| Molecular Formula | C26H27N3O5 |
| Molecular Weight | 461.52 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | N-[(2S)-4-[(3aR,6aR)-5-cyano-1,3-dioxo-3a,4,6,6a-tetrahydrocyclopenta[c]pyrrol-5-yl]-1-cyclopropyl-3-oxobutan-2-yl]-4-methoxy-1H-indene-2-carboxamide |
| SMILES | COc1cccc2c1C=C(C(=O)N[C@@H](CC1CC1)C(=O)CC1(C#N)C[C@H]3C(=O)NC(=O)[C@@H]3C1)C2 |
| InChI | InChI=1S/C26H27N3O5/c1-34-22-4-2-3-15-8-16(9-17(15)22)23(31)28-20(7-14-5-6-14)21(30)12-26(13-27)10-18-19(11-26)25(33)29-24(18)32/h2-4,9,14,18-20H,5-8,10-12H2,1H3,(H,28,31)(H,29,32,33)/t18-,19-,20+/m1/s1 |
| InChIKey | HKQXKGXUEDHLQE-AQNXPRMDSA-N |
| XLogP | 2.07 |
| TPSA | 125.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.52 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|