C25H32N4O5 — CID 167532470
N-[1-[[(2S)-1-amino-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-4-methoxy-1H-indene-2-carboxamide (PubChem CID 167532470) has the molecular formula C25H32N4O5 and a molecular weight of 468.55 g/mol. Its IUPAC name is N-[1-[[(2S)-1-amino-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-4-methoxy-1H-indene-2-carboxamide.
| Compound Name | N-[1-[[(2S)-1-amino-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-4-methoxy-1H-indene-2-carboxamide |
|---|---|
| PubChem CID | 167532470 |
| Molecular Formula | C25H32N4O5 |
| Molecular Weight | 468.55 g/mol |
| Exact Mass | 468.24 |
| IUPAC Name | N-[1-[[(2S)-1-amino-1-oxo-3-[(3S)-2-oxopiperidin-3-yl]propan-2-yl]amino]-3-cyclopropyl-1-oxopropan-2-yl]-4-methoxy-1H-indene-2-carboxamide |
| SMILES | COc1cccc2c1C=C(C(=O)NC(CC1CC1)C(=O)N[C@@H](C[C@@H]1CCCNC1=O)C(N)=O)C2 |
| InChI | InChI=1S/C25H32N4O5/c1-34-21-6-2-4-15-11-17(12-18(15)21)24(32)29-20(10-14-7-8-14)25(33)28-19(22(26)30)13-16-5-3-9-27-23(16)31/h2,4,6,12,14,16,19-20H,3,5,7-11,13H2,1H3,(H2,26,30)(H,27,31)(H,28,33)(H,29,32)/t16-,19-,20?/m0/s1 |
| InChIKey | MRSATRUCUMGYOC-QICOWLOGSA-N |
| XLogP | 0.81 |
| TPSA | 139.62 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.55 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |