C9H13B15N3O2S — CID 158509042
CID 158509042 (PubChem CID 158509042) has the molecular formula C9H13B15N3O2S and a molecular weight of 389.47 g/mol.
| Compound Name | CID 158509042 |
|---|---|
| PubChem CID | 158509042 |
| Molecular Formula | C9H13B15N3O2S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | — |
| SMILES | CCOC(=O)CSc1cc(C)nc(N)n1.[B][B]B([B])B(B([B])[B])B(B([B])[B])B([B])[B] |
| InChI | InChI=1S/C9H13N3O2S.B15/c1-3-14-8(13)5-15-7-4-6(2)11-9(10)12-7;1-9-13(8)15(12(6)7)14(10(2)3)11(4)5/h4H,3,5H2,1-2H3,(H2,10,11,12); |
| InChIKey | GYVCGOQZIGGUFE-UHFFFAOYSA-N |
| XLogP | -4.69 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | -4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|