C21H32N2O6 — CID 158511870
benzyl (4R)-7-amino-4-carbamoyl-6-oxooctanoate;tert-butyl formate (PubChem CID 158511870) has the molecular formula C21H32N2O6 and a molecular weight of 408.50 g/mol. Its IUPAC name is benzyl (4R)-7-amino-4-carbamoyl-6-oxooctanoate;tert-butyl formate.
| Compound Name | benzyl (4R)-7-amino-4-carbamoyl-6-oxooctanoate;tert-butyl formate |
|---|---|
| PubChem CID | 158511870 |
| Molecular Formula | C21H32N2O6 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.23 |
| IUPAC Name | benzyl (4R)-7-amino-4-carbamoyl-6-oxooctanoate;tert-butyl formate |
| SMILES | CC(C)(C)OC=O.CC(N)C(=O)C[C@@H](CCC(=O)OCc1ccccc1)C(N)=O |
| InChI | InChI=1S/C16H22N2O4.C5H10O2/c1-11(17)14(19)9-13(16(18)21)7-8-15(20)22-10-12-5-3-2-4-6-12;1-5(2,3)7-4-6/h2-6,11,13H,7-10,17H2,1H3,(H2,18,21);4H,1-3H3/t11?,13-;/m1./s1 |
| InChIKey | HLDUBWHEBMGKHU-ASSPZCQQSA-N |
| XLogP | 1.88 |
| TPSA | 138.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|