About carbon dioxide;ethyl (2E)-2-[(3-fluoro-4,5-dimethylanilino)methylidene]butanoate
carbon dioxide;ethyl (2E)-2-[(3-fluoro-4,5-dimethylanilino)methylidene]butanoate (PubChem CID 158515684) has the molecular formula C16H20FNO4
and a molecular weight of 309.34 g/mol. Its IUPAC name is carbon dioxide;ethyl (2E)-2-[(3-fluoro-4,5-dimethylanilino)methylidene]butanoate.
Molecular Properties
| Compound Name | carbon dioxide;ethyl (2E)-2-[(3-fluoro-4,5-dimethylanilino)methylidene]butanoate |
| PubChem CID | 158515684 |
| Molecular Formula | C16H20FNO4 |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.14 |
| IUPAC Name | carbon dioxide;ethyl (2E)-2-[(3-fluoro-4,5-dimethylanilino)methylidene]butanoate |
| SMILES | CCOC(=O)/C(=C/Nc1cc(C)c(C)c(F)c1)CC.O=C=O |
| InChI | InChI=1S/C15H20FNO2.CO2/c1-5-12(15(18)19-6-2)9-17-13-7-10(3)11(4)14(16)8-13;2-1-3/h7-9,17H,5-6H2,1-4H3;/b12-9+; |
| InChIKey | HLPCNLOKOUFGBS-NBYYMMLRSA-N |
| XLogP | 3.13 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze carbon dioxide;ethyl (2E)-2-[(3-fluoro-4,5-dimethylanilino)methylidene]butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbon dioxide;ethyl (2E)-2-[(3-fluoro-4,5-dimethylanilino)methylidene]butanoate?
The IUPAC name of carbon dioxide;ethyl (2E)-2-[(3-fluoro-4,5-dimethylanilino)methylidene]butanoate (CID 158515684) is carbon dioxide;ethyl (2E)-2-[(3-fluoro-4,5-dimethylanilino)methylidene]butanoate.
What is the SMILES notation for carbon dioxide;ethyl (2E)-2-[(3-fluoro-4,5-dimethylanilino)methylidene]butanoate?
The canonical SMILES for carbon dioxide;ethyl (2E)-2-[(3-fluoro-4,5-dimethylanilino)methylidene]butanoate is CCOC(=O)/C(=C/Nc1cc(C)c(C)c(F)c1)CC.O=C=O.
What is the InChIKey of carbon dioxide;ethyl (2E)-2-[(3-fluoro-4,5-dimethylanilino)methylidene]butanoate?
The InChIKey is HLPCNLOKOUFGBS-NBYYMMLRSA-N. The full InChI is InChI=1S/C15H20FNO2.CO2/c1-5-12(15(18)19-6-2)9-17-13-7-10(3)11(4)14(16)8-13;2-1-3/h7-9,17H,5-6H2,1-4H3;/b12-9+;.
What are the key properties of carbon dioxide;ethyl (2E)-2-[(3-fluoro-4,5-dimethylanilino)methylidene]butanoate?
carbon dioxide;ethyl (2E)-2-[(3-fluoro-4,5-dimethylanilino)methylidene]butanoate has a molecular weight of 309.34 g/mol, XLogP of 3.13, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for carbon dioxide;ethyl (2E)-2-[(3-fluoro-4,5-dimethylanilino)methylidene]butanoate is sourced from PubChem (CID 158515684), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).