C39H57N5O9 — CID 158516121
tert-butyl N-[2-[[(5S)-5-[[(2R)-2-benzyl-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxopentanoyl]amino]-7-methyl-4-oxooctanoyl]amino]ethyl]-N-methylcarbamate (PubChem CID 158516121) has the molecular formula C39H57N5O9 and a molecular weight of 739.91 g/mol. Its IUPAC name is tert-butyl N-[2-[[(5S)-5-[[(2R)-2-benzyl-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxopentanoyl]amino]-7-methyl-4-oxooctanoyl]amino]ethyl]-N-methylcarbamate.
| Compound Name | tert-butyl N-[2-[[(5S)-5-[[(2R)-2-benzyl-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxopentanoyl]amino]-7-methyl-4-oxooctanoyl]amino]ethyl]-N-methylcarbamate |
|---|---|
| PubChem CID | 158516121 |
| Molecular Formula | C39H57N5O9 |
| Molecular Weight | 739.91 g/mol |
| Exact Mass | 739.42 |
| IUPAC Name | tert-butyl N-[2-[[(5S)-5-[[(2R)-2-benzyl-5-[6-(2,5-dioxopyrrol-1-yl)hexanoylamino]-4-oxopentanoyl]amino]-7-methyl-4-oxooctanoyl]amino]ethyl]-N-methylcarbamate |
| SMILES | CC(C)C[C@H](NC(=O)[C@@H](CC(=O)CNC(=O)CCCCCN1C(=O)C=CC1=O)Cc1ccccc1)C(=O)CCC(=O)NCCN(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C39H57N5O9/c1-27(2)23-31(32(46)16-17-34(48)40-20-22-43(6)38(52)53-39(3,4)5)42-37(51)29(24-28-13-9-7-10-14-28)25-30(45)26-41-33(47)15-11-8-12-21-44-35(49)18-19-36(44)50/h7,9-10,13-14,18-19,27,29,31H,8,11-12,15-17,20-26H2,1-6H3,(H,40,48)(H,41,47)(H,42,51)/t29-,31+/m1/s1 |
| InChIKey | ZIGMIQPYHZJIRQ-VEEOACQBSA-N |
| XLogP | 3.27 |
| TPSA | 188.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 53 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.91 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|