C47H63B14N5O10S2 — CID 165074544
CID 165074544 (PubChem CID 165074544) has the molecular formula C47H63B14N5O10S2 and a molecular weight of 1073.55 g/mol.
| Compound Name | CID 165074544 |
|---|---|
| PubChem CID | 165074544 |
| Molecular Formula | C47H63B14N5O10S2 |
| Molecular Weight | 1073.55 g/mol |
| Exact Mass | 1075.53 |
| IUPAC Name | — |
| SMILES | [B]B=S(=B[B])(B([B])[B])C(=O)CCC(=O)C(CC(C)C)NC(=O)C(CC(=O)CNC(=O)CCC(N)C(=O)NCC(=O)CC(Cc1ccccc1)C(=O)NC(CC(C)C)C(=O)CCC(=O)S(=B[B])(=B[B])B([B])[B])Cc1ccccc1 |
| InChI | InChI=1S/C47H63B14N5O10S2/c1-29(2)21-38(40(69)16-19-43(72)77(56-48,57-49)60(52)53)65-45(74)33(23-31-11-7-5-8-12-31)25-35(67)27-63-42(71)18-15-37(62)47(76)64-28-36(68)26-34(24-32-13-9-6-10-14-32)46(75)66-39(22-30(3)4)41(70)17-20-44(73)78(58-50,59-51)61(54)55/h5-14,29-30,33-34,37-39H,15-28,62H2,1-4H3,(H,63,71)(H,64,76)(H,65,74)(H,66,75) |
| InChIKey | FSKKCHLFRIXOTF-UHFFFAOYSA-N |
| XLogP | -1.16 |
| TPSA | 244.84 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1073.55 |
| LogP ≤ 5 | -1.16 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|