C54H76B8N6O12PS — CID 165015576
CID 165015576 (PubChem CID 165015576) has the molecular formula C54H76B8N6O12PS and a molecular weight of 1150.77 g/mol.
| Compound Name | CID 165015576 |
|---|---|
| PubChem CID | 165015576 |
| Molecular Formula | C54H76B8N6O12PS |
| Molecular Weight | 1150.77 g/mol |
| Exact Mass | 1151.57 |
| IUPAC Name | — |
| SMILES | [B]B([B])B([B])B([B])SC(=O)CCC(=O)C(CC(C)C)NC(=O)C(CC(=O)CNC(=O)C(CCC(=O)NCC(=O)CC(Cc1ccccc1)C(=O)NC(CC(C)C)C(=O)CCC(=O)P[B]C)NC(=O)CNC(=O)CCC)Cc1ccccc1 |
| InChI | InChI=1S/C54H76B8N6O12PS/c1-7-14-47(73)64-33-49(75)66-42(19-22-48(74)63-31-40(69)29-38(27-36-15-10-8-11-16-36)52(78)67-43(25-34(2)3)45(71)20-23-50(76)81-59-6)54(80)65-32-41(70)30-39(28-37-17-12-9-13-18-37)53(79)68-44(26-35(4)5)46(72)21-24-51(77)82-62(58)61(57)60(55)56/h8-13,15-18,34-35,38-39,42-44,81H,7,14,19-33H2,1-6H3,(H,63,74)(H,64,73)(H,65,80)(H,66,75)(H,67,78)(H,68,79) |
| InChIKey | UTBBXVVNTJCSTN-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 277.02 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 42 |
| Heavy Atoms | 82 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1150.77 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|