C74H100B15N8O16PS2 — CID 165013760
CID 165013760 (PubChem CID 165013760) has the molecular formula C74H100B15N8O16PS2 and a molecular weight of 1614.94 g/mol.
| Compound Name | CID 165013760 |
|---|---|
| PubChem CID | 165013760 |
| Molecular Formula | C74H100B15N8O16PS2 |
| Molecular Weight | 1614.94 g/mol |
| Exact Mass | 1616.78 |
| IUPAC Name | — |
| SMILES | [B]B=S(=B[B])(B([B])[B])C(=O)CCC(=O)C(CC(C)C)NC(=O)C(CC(=O)CNC(=O)CCC(NC(=O)C(N)CCC(=O)NCC(=O)CC(Cc1ccccc1)C(=O)NC(CC(C)C)C(=O)CCC(=O)P([B])C)C(=O)NCC(=O)CC(Cc1ccccc1)C(=O)NC(CC(C)C)C(=O)CCC(=O)S(=B[B])(=B[B])B([B])[B])Cc1ccccc1 |
| InChI | InChI=1S/C74H100B15N8O16PS2/c1-45(2)33-59(62(101)25-30-67(106)114(7)83)95-70(109)51(36-48-17-11-8-12-18-48)39-54(98)42-91-65(104)28-23-57(90)73(112)94-58(74(113)93-44-56(100)41-53(38-50-21-15-10-16-22-50)72(111)97-61(35-47(5)6)64(103)27-32-69(108)116(86-77,87-78)89(81)82)24-29-66(105)92-43-55(99)40-52(37-49-19-13-9-14-20-49)71(110)96-60(34-46(3)4)63(102)26-31-68(107)115(84-75,85-76)88(79)80/h8-22,45-47,51-53,57-61H,23-44,90H2,1-7H3,(H,91,104)(H,92,105)(H,93,113)(H,94,112)(H,95,109)(H,96,110)(H,97,111) |
| InChIKey | VSGCUEFZBUCTRR-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 383.35 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 54 |
| Heavy Atoms | 116 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1614.94 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|