C43H29F6N3 — CID 158519683
9-[3-(1,8-dimethylcarbazol-9-yl)-4-[2-isocyano-6-(trifluoromethyl)phenyl]-2-(trifluoromethyl)phenyl]-1,8-dimethylcarbazole (PubChem CID 158519683) has the molecular formula C43H29F6N3 and a molecular weight of 701.71 g/mol. Its IUPAC name is 9-[3-(1,8-dimethylcarbazol-9-yl)-4-[2-isocyano-6-(trifluoromethyl)phenyl]-2-(trifluoromethyl)phenyl]-1,8-dimethylcarbazole.
| Compound Name | 9-[3-(1,8-dimethylcarbazol-9-yl)-4-[2-isocyano-6-(trifluoromethyl)phenyl]-2-(trifluoromethyl)phenyl]-1,8-dimethylcarbazole |
|---|---|
| PubChem CID | 158519683 |
| Molecular Formula | C43H29F6N3 |
| Molecular Weight | 701.71 g/mol |
| Exact Mass | 701.23 |
| IUPAC Name | 9-[3-(1,8-dimethylcarbazol-9-yl)-4-[2-isocyano-6-(trifluoromethyl)phenyl]-2-(trifluoromethyl)phenyl]-1,8-dimethylcarbazole |
| SMILES | [C-]#[N+]c1cccc(C(F)(F)F)c1-c1ccc(-n2c3c(C)cccc3c3cccc(C)c32)c(C(F)(F)F)c1-n1c2c(C)cccc2c2cccc(C)c21 |
| InChI | InChI=1S/C43H29F6N3/c1-23-11-6-15-27-28-16-7-12-24(2)38(28)51(37(23)27)34-22-21-31(35-32(42(44,45)46)19-10-20-33(35)50-5)41(36(34)43(47,48)49)52-39-25(3)13-8-17-29(39)30-18-9-14-26(4)40(30)52/h6-22H,1-4H3 |
| InChIKey | HTDOUPIFBXQMBP-UHFFFAOYSA-N |
| XLogP | 13.37 |
| TPSA | 14.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 701.71 |
| LogP ≤ 5 | 13.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|