C41H25F6N3 — CID 158930105
9-[4-[3-isocyano-5-(trifluoromethyl)phenyl]-2-(1-methylcarbazol-9-yl)-6-(trifluoromethyl)phenyl]-1-methylcarbazole (PubChem CID 158930105) has the molecular formula C41H25F6N3 and a molecular weight of 673.66 g/mol. Its IUPAC name is 9-[4-[3-isocyano-5-(trifluoromethyl)phenyl]-2-(1-methylcarbazol-9-yl)-6-(trifluoromethyl)phenyl]-1-methylcarbazole.
| Compound Name | 9-[4-[3-isocyano-5-(trifluoromethyl)phenyl]-2-(1-methylcarbazol-9-yl)-6-(trifluoromethyl)phenyl]-1-methylcarbazole |
|---|---|
| PubChem CID | 158930105 |
| Molecular Formula | C41H25F6N3 |
| Molecular Weight | 673.66 g/mol |
| Exact Mass | 673.20 |
| IUPAC Name | 9-[4-[3-isocyano-5-(trifluoromethyl)phenyl]-2-(1-methylcarbazol-9-yl)-6-(trifluoromethyl)phenyl]-1-methylcarbazole |
| SMILES | [C-]#[N+]c1cc(-c2cc(-n3c4ccccc4c4cccc(C)c43)c(-n3c4ccccc4c4cccc(C)c43)c(C(F)(F)F)c2)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C41H25F6N3/c1-23-10-8-14-31-29-12-4-6-16-34(29)49(37(23)31)36-21-26(25-18-27(40(42,43)44)22-28(19-25)48-3)20-33(41(45,46)47)39(36)50-35-17-7-5-13-30(35)32-15-9-11-24(2)38(32)50/h4-22H,1-2H3 |
| InChIKey | BXTSIVFEFCAOFO-UHFFFAOYSA-N |
| XLogP | 12.75 |
| TPSA | 14.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 673.66 |
| LogP ≤ 5 | 12.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|