About N-[bis(methylsulfanyl)methylidene]-4-bromobenzamide;4-bromobenzamide
N-[bis(methylsulfanyl)methylidene]-4-bromobenzamide;4-bromobenzamide (PubChem CID 158530203) has the molecular formula C17H16Br2N2O2S2
and a molecular weight of 504.27 g/mol. Its IUPAC name is N-[bis(methylsulfanyl)methylidene]-4-bromobenzamide;4-bromobenzamide.
Molecular Properties
| Compound Name | N-[bis(methylsulfanyl)methylidene]-4-bromobenzamide;4-bromobenzamide |
| PubChem CID | 158530203 |
| Molecular Formula | C17H16Br2N2O2S2 |
| Molecular Weight | 504.27 g/mol |
| Exact Mass | 501.90 |
| IUPAC Name | N-[bis(methylsulfanyl)methylidene]-4-bromobenzamide;4-bromobenzamide |
| SMILES | CSC(=NC(=O)c1ccc(Br)cc1)SC.NC(=O)c1ccc(Br)cc1 |
| InChI | InChI=1S/C10H10BrNOS2.C7H6BrNO/c1-14-10(15-2)12-9(13)7-3-5-8(11)6-4-7;8-6-3-1-5(2-4-6)7(9)10/h3-6H,1-2H3;1-4H,(H2,9,10) |
| InChIKey | HNGSWOXMNSCKCM-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 504.27 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-[bis(methylsulfanyl)methylidene]-4-bromobenzamide;4-bromobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[bis(methylsulfanyl)methylidene]-4-bromobenzamide;4-bromobenzamide?
The IUPAC name of N-[bis(methylsulfanyl)methylidene]-4-bromobenzamide;4-bromobenzamide (CID 158530203) is N-[bis(methylsulfanyl)methylidene]-4-bromobenzamide;4-bromobenzamide.
What is the SMILES notation for N-[bis(methylsulfanyl)methylidene]-4-bromobenzamide;4-bromobenzamide?
The canonical SMILES for N-[bis(methylsulfanyl)methylidene]-4-bromobenzamide;4-bromobenzamide is CSC(=NC(=O)c1ccc(Br)cc1)SC.NC(=O)c1ccc(Br)cc1.
What is the InChIKey of N-[bis(methylsulfanyl)methylidene]-4-bromobenzamide;4-bromobenzamide?
The InChIKey is HNGSWOXMNSCKCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10BrNOS2.C7H6BrNO/c1-14-10(15-2)12-9(13)7-3-5-8(11)6-4-7;8-6-3-1-5(2-4-6)7(9)10/h3-6H,1-2H3;1-4H,(H2,9,10).
What are the key properties of N-[bis(methylsulfanyl)methylidene]-4-bromobenzamide;4-bromobenzamide?
N-[bis(methylsulfanyl)methylidene]-4-bromobenzamide;4-bromobenzamide has a molecular weight of 504.27 g/mol, XLogP of 5.22, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[bis(methylsulfanyl)methylidene]-4-bromobenzamide;4-bromobenzamide is sourced from PubChem (CID 158530203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).