C34H44BBrN2O2 — CID 158538050
2-bromo-5-tert-butyl-1,3-dimethylbenzene;4-(4-tert-butyl-2,6-dimethylphenyl)pyridine;pyridin-4-ylboronic acid (PubChem CID 158538050) has the molecular formula C34H44BBrN2O2 and a molecular weight of 603.45 g/mol. Its IUPAC name is 2-bromo-5-tert-butyl-1,3-dimethylbenzene;4-(4-tert-butyl-2,6-dimethylphenyl)pyridine;pyridin-4-ylboronic acid.
| Compound Name | 2-bromo-5-tert-butyl-1,3-dimethylbenzene;4-(4-tert-butyl-2,6-dimethylphenyl)pyridine;pyridin-4-ylboronic acid |
|---|---|
| PubChem CID | 158538050 |
| Molecular Formula | C34H44BBrN2O2 |
| Molecular Weight | 603.45 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 2-bromo-5-tert-butyl-1,3-dimethylbenzene;4-(4-tert-butyl-2,6-dimethylphenyl)pyridine;pyridin-4-ylboronic acid |
| SMILES | Cc1cc(C(C)(C)C)cc(C)c1-c1ccncc1.Cc1cc(C(C)(C)C)cc(C)c1Br.OB(O)c1ccncc1 |
| InChI | InChI=1S/C17H21N.C12H17Br.C5H6BNO2/c1-12-10-15(17(3,4)5)11-13(2)16(12)14-6-8-18-9-7-14;1-8-6-10(12(3,4)5)7-9(2)11(8)13;8-6(9)5-1-3-7-4-2-5/h6-11H,1-5H3;6-7H,1-5H3;1-4,8-9H |
| InChIKey | HOEKCELPOBUJJZ-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.45 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|