C21H16N2O3 — CID 158544031
4-methyl-6-(2-nitrophenyl)-4-azatricyclo[7.6.0.03,7]pentadeca-1(15),2,7,9,11,13-hexaen-5-one (PubChem CID 158544031) has the molecular formula C21H16N2O3 and a molecular weight of 344.37 g/mol. Its IUPAC name is 4-methyl-6-(2-nitrophenyl)-4-azatricyclo[7.6.0.03,7]pentadeca-1(15),2,7,9,11,13-hexaen-5-one.
| Compound Name | 4-methyl-6-(2-nitrophenyl)-4-azatricyclo[7.6.0.03,7]pentadeca-1(15),2,7,9,11,13-hexaen-5-one |
|---|---|
| PubChem CID | 158544031 |
| Molecular Formula | C21H16N2O3 |
| Molecular Weight | 344.37 g/mol |
| Exact Mass | 344.12 |
| IUPAC Name | 4-methyl-6-(2-nitrophenyl)-4-azatricyclo[7.6.0.03,7]pentadeca-1(15),2,7,9,11,13-hexaen-5-one |
| SMILES | CN1C(=O)C(c2ccccc2[N+](=O)[O-])c2cc3c(cc21)=CC=CC=CC=3 |
| InChI | InChI=1S/C21H16N2O3/c1-22-19-13-15-9-5-3-2-4-8-14(15)12-17(19)20(21(22)24)16-10-6-7-11-18(16)23(25)26/h2-13,20H,1H3 |
| InChIKey | HOWNAUAJNIITDI-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 63.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.37 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|