C44H69N3O8 — CID 158558955
benzyl 4-[[(2S)-2-amino-3,3-dimethylbutyl]amino]-3,3-dimethyl-4-oxobutanoate;tert-butyl (3S)-3-[[(2,2-dimethyl-4-oxo-4-phenylmethoxybutanoyl)amino]methyl]-4,4-dimethylpentanoate (PubChem CID 158558955) has the molecular formula C44H69N3O8 and a molecular weight of 768.05 g/mol. Its IUPAC name is benzyl 4-[[(2S)-2-amino-3,3-dimethylbutyl]amino]-3,3-dimethyl-4-oxobutanoate;tert-butyl (3S)-3-[[(2,2-dimethyl-4-oxo-4-phenylmethoxybutanoyl)amino]methyl]-4,4-dimethylpentanoate.
| Compound Name | benzyl 4-[[(2S)-2-amino-3,3-dimethylbutyl]amino]-3,3-dimethyl-4-oxobutanoate;tert-butyl (3S)-3-[[(2,2-dimethyl-4-oxo-4-phenylmethoxybutanoyl)amino]methyl]-4,4-dimethylpentanoate |
|---|---|
| PubChem CID | 158558955 |
| Molecular Formula | C44H69N3O8 |
| Molecular Weight | 768.05 g/mol |
| Exact Mass | 767.51 |
| IUPAC Name | benzyl 4-[[(2S)-2-amino-3,3-dimethylbutyl]amino]-3,3-dimethyl-4-oxobutanoate;tert-butyl (3S)-3-[[(2,2-dimethyl-4-oxo-4-phenylmethoxybutanoyl)amino]methyl]-4,4-dimethylpentanoate |
| SMILES | CC(C)(C)OC(=O)CC(CNC(=O)C(C)(C)CC(=O)OCc1ccccc1)C(C)(C)C.CC(C)(CC(=O)OCc1ccccc1)C(=O)NC[C@@H](N)C(C)(C)C |
| InChI | InChI=1S/C25H39NO5.C19H30N2O3/c1-23(2,3)19(14-20(27)31-24(4,5)6)16-26-22(29)25(7,8)15-21(28)30-17-18-12-10-9-11-13-18;1-18(2,3)15(20)12-21-17(23)19(4,5)11-16(22)24-13-14-9-7-6-8-10-14/h9-13,19H,14-17H2,1-8H3,(H,26,29);6-10,15H,11-13,20H2,1-5H3,(H,21,23)/t;15-/m.1/s1 |
| InChIKey | HQQIZMKSAMHXTR-DYYGGQLPSA-N |
| XLogP | 7.29 |
| TPSA | 163.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 55 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 768.05 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|