C24H20BCl3N8O2 — CID 158562813
7-chloro-2-methyl-5-phenyl-[1,2,4]triazolo[1,5-c]pyrimidine;5,7-dichloro-2-methyl-[1,2,4]triazolo[1,5-c]pyrimidine;phenylboronic acid (PubChem CID 158562813) has the molecular formula C24H20BCl3N8O2 and a molecular weight of 569.65 g/mol. Its IUPAC name is 7-chloro-2-methyl-5-phenyl-[1,2,4]triazolo[1,5-c]pyrimidine;5,7-dichloro-2-methyl-[1,2,4]triazolo[1,5-c]pyrimidine;phenylboronic acid.
| Compound Name | 7-chloro-2-methyl-5-phenyl-[1,2,4]triazolo[1,5-c]pyrimidine;5,7-dichloro-2-methyl-[1,2,4]triazolo[1,5-c]pyrimidine;phenylboronic acid |
|---|---|
| PubChem CID | 158562813 |
| Molecular Formula | C24H20BCl3N8O2 |
| Molecular Weight | 569.65 g/mol |
| Exact Mass | 568.09 |
| IUPAC Name | 7-chloro-2-methyl-5-phenyl-[1,2,4]triazolo[1,5-c]pyrimidine;5,7-dichloro-2-methyl-[1,2,4]triazolo[1,5-c]pyrimidine;phenylboronic acid |
| SMILES | Cc1nc2cc(Cl)nc(-c3ccccc3)n2n1.Cc1nc2cc(Cl)nc(Cl)n2n1.OB(O)c1ccccc1 |
| InChI | InChI=1S/C12H9ClN4.C6H7BO2.C6H4Cl2N4/c1-8-14-11-7-10(13)15-12(17(11)16-8)9-5-3-2-4-6-9;8-7(9)6-4-2-1-3-5-6;1-3-9-5-2-4(7)10-6(8)12(5)11-3/h2-7H,1H3;1-5,8-9H;2H,1H3 |
| InChIKey | HRCDEWOFTWUMCW-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 126.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.65 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|