C34H38BBrF2N4O4 — CID 158571442
1-bromo-3-cyclopropyloxybenzene;5-(3-cyclopropyloxyphenyl)-3-fluoropyridin-2-amine;3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine (PubChem CID 158571442) has the molecular formula C34H38BBrF2N4O4 and a molecular weight of 695.41 g/mol. Its IUPAC name is 1-bromo-3-cyclopropyloxybenzene;5-(3-cyclopropyloxyphenyl)-3-fluoropyridin-2-amine;3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine.
| Compound Name | 1-bromo-3-cyclopropyloxybenzene;5-(3-cyclopropyloxyphenyl)-3-fluoropyridin-2-amine;3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
|---|---|
| PubChem CID | 158571442 |
| Molecular Formula | C34H38BBrF2N4O4 |
| Molecular Weight | 695.41 g/mol |
| Exact Mass | 694.21 |
| IUPAC Name | 1-bromo-3-cyclopropyloxybenzene;5-(3-cyclopropyloxyphenyl)-3-fluoropyridin-2-amine;3-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridin-2-amine |
| SMILES | Brc1cccc(OC2CC2)c1.CC1(C)OB(c2cnc(N)c(F)c2)OC1(C)C.Nc1ncc(-c2cccc(OC3CC3)c2)cc1F |
| InChI | InChI=1S/C14H13FN2O.C11H16BFN2O2.C9H9BrO/c15-13-7-10(8-17-14(13)16)9-2-1-3-12(6-9)18-11-4-5-11;1-10(2)11(3,4)17-12(16-10)7-5-8(13)9(14)15-6-7;10-7-2-1-3-9(6-7)11-8-4-5-8/h1-3,6-8,11H,4-5H2,(H2,16,17);5-6H,1-4H3,(H2,14,15);1-3,6,8H,4-5H2 |
| InChIKey | HSDANCGJJGLBRG-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 114.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 695.41 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|