C27H33NO4 — CID 158575252
4-propoxybenzaldehyde;2-[(4-propoxyphenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one (PubChem CID 158575252) has the molecular formula C27H33NO4 and a molecular weight of 435.56 g/mol. Its IUPAC name is 4-propoxybenzaldehyde;2-[(4-propoxyphenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one.
| Compound Name | 4-propoxybenzaldehyde;2-[(4-propoxyphenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one |
|---|---|
| PubChem CID | 158575252 |
| Molecular Formula | C27H33NO4 |
| Molecular Weight | 435.56 g/mol |
| Exact Mass | 435.24 |
| IUPAC Name | 4-propoxybenzaldehyde;2-[(4-propoxyphenyl)methylidene]-1-azabicyclo[2.2.2]octan-3-one |
| SMILES | CCCOc1ccc(C=C2C(=O)C3CCN2CC3)cc1.CCCOc1ccc(C=O)cc1 |
| InChI | InChI=1S/C17H21NO2.C10H12O2/c1-2-11-20-15-5-3-13(4-6-15)12-16-17(19)14-7-9-18(16)10-8-14;1-2-7-12-10-5-3-9(8-11)4-6-10/h3-6,12,14H,2,7-11H2,1H3;3-6,8H,2,7H2,1H3 |
| InChIKey | HSORBHNYJPBJQE-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.56 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|