C20H27ClN2O6 — CID 158579052
(3-aminophenyl)methanol;ethyl carbonochloridate;ethyl N-[3-(hydroxymethyl)phenyl]carbamate (PubChem CID 158579052) has the molecular formula C20H27ClN2O6 and a molecular weight of 426.90 g/mol. Its IUPAC name is (3-aminophenyl)methanol;ethyl carbonochloridate;ethyl N-[3-(hydroxymethyl)phenyl]carbamate.
| Compound Name | (3-aminophenyl)methanol;ethyl carbonochloridate;ethyl N-[3-(hydroxymethyl)phenyl]carbamate |
|---|---|
| PubChem CID | 158579052 |
| Molecular Formula | C20H27ClN2O6 |
| Molecular Weight | 426.90 g/mol |
| Exact Mass | 426.16 |
| IUPAC Name | (3-aminophenyl)methanol;ethyl carbonochloridate;ethyl N-[3-(hydroxymethyl)phenyl]carbamate |
| SMILES | CCOC(=O)Cl.CCOC(=O)Nc1cccc(CO)c1.Nc1cccc(CO)c1 |
| InChI | InChI=1S/C10H13NO3.C7H9NO.C3H5ClO2/c1-2-14-10(13)11-9-5-3-4-8(6-9)7-12;8-7-3-1-2-6(4-7)5-9;1-2-6-3(4)5/h3-6,12H,2,7H2,1H3,(H,11,13);1-4,9H,5,8H2;2H2,1H3 |
| InChIKey | HTAGJVHQEPDFJL-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 131.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.90 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|