C31H25BrN10S2 — CID 158579818
2-N-[2-[[2-[[4-amino-6-(3-methylphenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(3-bromophenyl)-1,3,5-triazine-2,4-diamine (PubChem CID 158579818) has the molecular formula C31H25BrN10S2 and a molecular weight of 681.65 g/mol. Its IUPAC name is 2-N-[2-[[2-[[4-amino-6-(3-methylphenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(3-bromophenyl)-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-[2-[[2-[[4-amino-6-(3-methylphenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(3-bromophenyl)-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 158579818 |
| Molecular Formula | C31H25BrN10S2 |
| Molecular Weight | 681.65 g/mol |
| Exact Mass | 680.09 |
| IUPAC Name | 2-N-[2-[[2-[[4-amino-6-(3-methylphenyl)-1,3,5-triazin-2-yl]amino]phenyl]disulfanyl]phenyl]-6-(3-bromophenyl)-1,3,5-triazine-2,4-diamine |
| SMILES | Cc1cccc(-c2nc(N)nc(Nc3ccccc3SSc3ccccc3Nc3nc(N)nc(-c4cccc(Br)c4)n3)n2)c1 |
| InChI | InChI=1S/C31H25BrN10S2/c1-18-8-6-9-19(16-18)26-37-28(33)41-30(39-26)35-22-12-2-4-14-24(22)43-44-25-15-5-3-13-23(25)36-31-40-27(38-29(34)42-31)20-10-7-11-21(32)17-20/h2-17H,1H3,(H3,33,35,37,39,41)(H3,34,36,38,40,42) |
| InChIKey | AALHOTRDRQLUEB-UHFFFAOYSA-N |
| XLogP | 7.91 |
| TPSA | 153.44 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.65 |
| LogP ≤ 5 | 7.91 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|