C39H30ClF6N7O3 — CID 158587331
4-chloro-1-(4-methoxyphenyl)-7-(trifluoromethyl)imidazo[4,5-c]quinoline;3-[[1-(4-methoxyphenyl)-7-(trifluoromethyl)imidazo[4,5-c]quinolin-4-yl]amino]propan-1-ol (PubChem CID 158587331) has the molecular formula C39H30ClF6N7O3 and a molecular weight of 794.16 g/mol. Its IUPAC name is 4-chloro-1-(4-methoxyphenyl)-7-(trifluoromethyl)imidazo[4,5-c]quinoline;3-[[1-(4-methoxyphenyl)-7-(trifluoromethyl)imidazo[4,5-c]quinolin-4-yl]amino]propan-1-ol.
| Compound Name | 4-chloro-1-(4-methoxyphenyl)-7-(trifluoromethyl)imidazo[4,5-c]quinoline;3-[[1-(4-methoxyphenyl)-7-(trifluoromethyl)imidazo[4,5-c]quinolin-4-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 158587331 |
| Molecular Formula | C39H30ClF6N7O3 |
| Molecular Weight | 794.16 g/mol |
| Exact Mass | 793.20 |
| IUPAC Name | 4-chloro-1-(4-methoxyphenyl)-7-(trifluoromethyl)imidazo[4,5-c]quinoline;3-[[1-(4-methoxyphenyl)-7-(trifluoromethyl)imidazo[4,5-c]quinolin-4-yl]amino]propan-1-ol |
| SMILES | COc1ccc(-n2cnc3c(Cl)nc4cc(C(F)(F)F)ccc4c32)cc1.COc1ccc(-n2cnc3c(NCCCO)nc4cc(C(F)(F)F)ccc4c32)cc1 |
| InChI | InChI=1S/C21H19F3N4O2.C18H11ClF3N3O/c1-30-15-6-4-14(5-7-15)28-12-26-18-19(28)16-8-3-13(21(22,23)24)11-17(16)27-20(18)25-9-2-10-29;1-26-12-5-3-11(4-6-12)25-9-23-15-16(25)13-7-2-10(18(20,21)22)8-14(13)24-17(15)19/h3-8,11-12,29H,2,9-10H2,1H3,(H,25,27);2-9H,1H3 |
| InChIKey | HTZKLBKCPLLYGW-UHFFFAOYSA-N |
| XLogP | 9.65 |
| TPSA | 112.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 794.16 |
| LogP ≤ 5 | 9.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|