C20H27FN2O2 — CID 158589704
5-[(4-fluoro-2-methylphenyl)methoxy]-1-(oxan-2-ylmethyl)-3-propylpyrazole (PubChem CID 158589704) has the molecular formula C20H27FN2O2 and a molecular weight of 346.45 g/mol. Its IUPAC name is 5-[(4-fluoro-2-methylphenyl)methoxy]-1-(oxan-2-ylmethyl)-3-propylpyrazole.
| Compound Name | 5-[(4-fluoro-2-methylphenyl)methoxy]-1-(oxan-2-ylmethyl)-3-propylpyrazole |
|---|---|
| PubChem CID | 158589704 |
| Molecular Formula | C20H27FN2O2 |
| Molecular Weight | 346.45 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | 5-[(4-fluoro-2-methylphenyl)methoxy]-1-(oxan-2-ylmethyl)-3-propylpyrazole |
| SMILES | CCCc1cc(OCc2ccc(F)cc2C)n(CC2CCCCO2)n1 |
| InChI | InChI=1S/C20H27FN2O2/c1-3-6-18-12-20(23(22-18)13-19-7-4-5-10-24-19)25-14-16-8-9-17(21)11-15(16)2/h8-9,11-12,19H,3-7,10,13-14H2,1-2H3 |
| InChIKey | HUHGPALHIJXJSK-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 36.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.45 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |