C19H24ClFN2O — CID 162239924
5-[(2-chloro-4-fluorophenyl)methoxy]-1-(cyclopentylmethyl)-3-propylpyrazole (PubChem CID 162239924) has the molecular formula C19H24ClFN2O and a molecular weight of 350.87 g/mol. Its IUPAC name is 5-[(2-chloro-4-fluorophenyl)methoxy]-1-(cyclopentylmethyl)-3-propylpyrazole.
| Compound Name | 5-[(2-chloro-4-fluorophenyl)methoxy]-1-(cyclopentylmethyl)-3-propylpyrazole |
|---|---|
| PubChem CID | 162239924 |
| Molecular Formula | C19H24ClFN2O |
| Molecular Weight | 350.87 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 5-[(2-chloro-4-fluorophenyl)methoxy]-1-(cyclopentylmethyl)-3-propylpyrazole |
| SMILES | CCCc1cc(OCc2ccc(F)cc2Cl)n(CC2CCCC2)n1 |
| InChI | InChI=1S/C19H24ClFN2O/c1-2-5-17-11-19(23(22-17)12-14-6-3-4-7-14)24-13-15-8-9-16(21)10-18(15)20/h8-11,14H,2-7,12-13H2,1H3 |
| InChIKey | ZWOGIUNSRNACIU-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.87 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |