About formamide;N-pentan-3-ylidenehydroxylamine
formamide;N-pentan-3-ylidenehydroxylamine (PubChem CID 158590176) has the molecular formula C6H14N2O2
and a molecular weight of 146.19 g/mol. Its IUPAC name is formamide;N-pentan-3-ylidenehydroxylamine.
Molecular Properties
| Compound Name | formamide;N-pentan-3-ylidenehydroxylamine |
| PubChem CID | 158590176 |
| Molecular Formula | C6H14N2O2 |
| Molecular Weight | 146.19 g/mol |
| Exact Mass | 146.11 |
| IUPAC Name | formamide;N-pentan-3-ylidenehydroxylamine |
| SMILES | CCC(CC)=NO.NC=O |
| InChI | InChI=1S/C5H11NO.CH3NO/c1-3-5(4-2)6-7;2-1-3/h7H,3-4H2,1-2H3;1H,(H2,2,3) |
| InChIKey | HUIQSJNIDKEXMG-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 75.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.19 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze formamide;N-pentan-3-ylidenehydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formamide;N-pentan-3-ylidenehydroxylamine?
The IUPAC name of formamide;N-pentan-3-ylidenehydroxylamine (CID 158590176) is formamide;N-pentan-3-ylidenehydroxylamine.
What is the SMILES notation for formamide;N-pentan-3-ylidenehydroxylamine?
The canonical SMILES for formamide;N-pentan-3-ylidenehydroxylamine is CCC(CC)=NO.NC=O.
What is the InChIKey of formamide;N-pentan-3-ylidenehydroxylamine?
The InChIKey is HUIQSJNIDKEXMG-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.CH3NO/c1-3-5(4-2)6-7;2-1-3/h7H,3-4H2,1-2H3;1H,(H2,2,3).
What are the key properties of formamide;N-pentan-3-ylidenehydroxylamine?
formamide;N-pentan-3-ylidenehydroxylamine has a molecular weight of 146.19 g/mol, XLogP of 0.74, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formamide;N-pentan-3-ylidenehydroxylamine is sourced from PubChem (CID 158590176), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).