About (NZ)-N-butan-2-ylidenehydroxylamine;N-pentan-3-ylidenehydroxylamine
(NZ)-N-butan-2-ylidenehydroxylamine;N-pentan-3-ylidenehydroxylamine (PubChem CID 172954644) has the molecular formula C9H20N2O2
and a molecular weight of 188.27 g/mol. Its IUPAC name is (NZ)-N-butan-2-ylidenehydroxylamine;N-pentan-3-ylidenehydroxylamine.
Molecular Properties
| Compound Name | (NZ)-N-butan-2-ylidenehydroxylamine;N-pentan-3-ylidenehydroxylamine |
| PubChem CID | 172954644 |
| Molecular Formula | C9H20N2O2 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.15 |
| IUPAC Name | (NZ)-N-butan-2-ylidenehydroxylamine;N-pentan-3-ylidenehydroxylamine |
| SMILES | CC/C(C)=N\O.CCC(CC)=NO |
| InChI | InChI=1S/C5H11NO.C4H9NO/c1-3-5(4-2)6-7;1-3-4(2)5-6/h7H,3-4H2,1-2H3;6H,3H2,1-2H3/b;5-4- |
| InChIKey | OMCSHNABVQCJNA-GUHKXDMSSA-N |
| XLogP | 2.88 |
| TPSA | 65.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (NZ)-N-butan-2-ylidenehydroxylamine;N-pentan-3-ylidenehydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (NZ)-N-butan-2-ylidenehydroxylamine;N-pentan-3-ylidenehydroxylamine?
The IUPAC name of (NZ)-N-butan-2-ylidenehydroxylamine;N-pentan-3-ylidenehydroxylamine (CID 172954644) is (NZ)-N-butan-2-ylidenehydroxylamine;N-pentan-3-ylidenehydroxylamine.
What is the SMILES notation for (NZ)-N-butan-2-ylidenehydroxylamine;N-pentan-3-ylidenehydroxylamine?
The canonical SMILES for (NZ)-N-butan-2-ylidenehydroxylamine;N-pentan-3-ylidenehydroxylamine is CC/C(C)=N\O.CCC(CC)=NO.
What is the InChIKey of (NZ)-N-butan-2-ylidenehydroxylamine;N-pentan-3-ylidenehydroxylamine?
The InChIKey is OMCSHNABVQCJNA-GUHKXDMSSA-N. The full InChI is InChI=1S/C5H11NO.C4H9NO/c1-3-5(4-2)6-7;1-3-4(2)5-6/h7H,3-4H2,1-2H3;6H,3H2,1-2H3/b;5-4-.
What are the key properties of (NZ)-N-butan-2-ylidenehydroxylamine;N-pentan-3-ylidenehydroxylamine?
(NZ)-N-butan-2-ylidenehydroxylamine;N-pentan-3-ylidenehydroxylamine has a molecular weight of 188.27 g/mol, XLogP of 2.88, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (NZ)-N-butan-2-ylidenehydroxylamine;N-pentan-3-ylidenehydroxylamine is sourced from PubChem (CID 172954644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).