About bis(N-butan-2-ylidenehydroxylamine);N-(1-phenyl-1-silylbutan-2-ylidene)hydroxylamine
bis(N-butan-2-ylidenehydroxylamine);N-(1-phenyl-1-silylbutan-2-ylidene)hydroxylamine (PubChem CID 173213543) has the molecular formula C18H33N3O3Si
and a molecular weight of 367.57 g/mol. Its IUPAC name is bis(N-butan-2-ylidenehydroxylamine);N-(1-phenyl-1-silylbutan-2-ylidene)hydroxylamine.
Molecular Properties
| Compound Name | bis(N-butan-2-ylidenehydroxylamine);N-(1-phenyl-1-silylbutan-2-ylidene)hydroxylamine |
| PubChem CID | 173213543 |
| Molecular Formula | C18H33N3O3Si |
| Molecular Weight | 367.57 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | bis(N-butan-2-ylidenehydroxylamine);N-(1-phenyl-1-silylbutan-2-ylidene)hydroxylamine |
| SMILES | CCC(=NO)C([SiH3])c1ccccc1.CCC(C)=NO.CCC(C)=NO |
| InChI | InChI=1S/C10H15NOSi.2C4H9NO/c1-2-9(11-12)10(13)8-6-4-3-5-7-8;2*1-3-4(2)5-6/h3-7,10,12H,2H2,1,13H3;2*6H,3H2,1-2H3 |
| InChIKey | GCETUOCYRNFEJH-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.57 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze bis(N-butan-2-ylidenehydroxylamine);N-(1-phenyl-1-silylbutan-2-ylidene)hydroxylamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(N-butan-2-ylidenehydroxylamine);N-(1-phenyl-1-silylbutan-2-ylidene)hydroxylamine?
The IUPAC name of bis(N-butan-2-ylidenehydroxylamine);N-(1-phenyl-1-silylbutan-2-ylidene)hydroxylamine (CID 173213543) is bis(N-butan-2-ylidenehydroxylamine);N-(1-phenyl-1-silylbutan-2-ylidene)hydroxylamine.
What is the SMILES notation for bis(N-butan-2-ylidenehydroxylamine);N-(1-phenyl-1-silylbutan-2-ylidene)hydroxylamine?
The canonical SMILES for bis(N-butan-2-ylidenehydroxylamine);N-(1-phenyl-1-silylbutan-2-ylidene)hydroxylamine is CCC(=NO)C([SiH3])c1ccccc1.CCC(C)=NO.CCC(C)=NO.
What is the InChIKey of bis(N-butan-2-ylidenehydroxylamine);N-(1-phenyl-1-silylbutan-2-ylidene)hydroxylamine?
The InChIKey is GCETUOCYRNFEJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H15NOSi.2C4H9NO/c1-2-9(11-12)10(13)8-6-4-3-5-7-8;2*1-3-4(2)5-6/h3-7,10,12H,2H2,1,13H3;2*6H,3H2,1-2H3.
What are the key properties of bis(N-butan-2-ylidenehydroxylamine);N-(1-phenyl-1-silylbutan-2-ylidene)hydroxylamine?
bis(N-butan-2-ylidenehydroxylamine);N-(1-phenyl-1-silylbutan-2-ylidene)hydroxylamine has a molecular weight of 367.57 g/mol, XLogP of 3.83, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(N-butan-2-ylidenehydroxylamine);N-(1-phenyl-1-silylbutan-2-ylidene)hydroxylamine is sourced from PubChem (CID 173213543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).