About N-butan-2-ylidenehydroxylamine;carbonic acid
N-butan-2-ylidenehydroxylamine;carbonic acid (PubChem CID 87857804) has the molecular formula C5H11NO4
and a molecular weight of 149.15 g/mol. Its IUPAC name is N-butan-2-ylidenehydroxylamine;carbonic acid.
Molecular Properties
| Compound Name | N-butan-2-ylidenehydroxylamine;carbonic acid |
| PubChem CID | 87857804 |
| Molecular Formula | C5H11NO4 |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | N-butan-2-ylidenehydroxylamine;carbonic acid |
| SMILES | CCC(C)=NO.O=C(O)O |
| InChI | InChI=1S/C4H9NO.CH2O3/c1-3-4(2)5-6;2-1(3)4/h6H,3H2,1-2H3;(H2,2,3,4) |
| InChIKey | ZGQPHZAUVCGLBO-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 90.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-ylidenehydroxylamine;carbonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-ylidenehydroxylamine;carbonic acid?
The IUPAC name of N-butan-2-ylidenehydroxylamine;carbonic acid (CID 87857804) is N-butan-2-ylidenehydroxylamine;carbonic acid.
What is the SMILES notation for N-butan-2-ylidenehydroxylamine;carbonic acid?
The canonical SMILES for N-butan-2-ylidenehydroxylamine;carbonic acid is CCC(C)=NO.O=C(O)O.
What is the InChIKey of N-butan-2-ylidenehydroxylamine;carbonic acid?
The InChIKey is ZGQPHZAUVCGLBO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.CH2O3/c1-3-4(2)5-6;2-1(3)4/h6H,3H2,1-2H3;(H2,2,3,4).
What are the key properties of N-butan-2-ylidenehydroxylamine;carbonic acid?
N-butan-2-ylidenehydroxylamine;carbonic acid has a molecular weight of 149.15 g/mol, XLogP of 1.47, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-ylidenehydroxylamine;carbonic acid is sourced from PubChem (CID 87857804), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).