About azane;propanoic acid;hydrofluoride
azane;propanoic acid;hydrofluoride (PubChem CID 174943472) has the molecular formula C3H10FNO2
and a molecular weight of 111.12 g/mol. Its IUPAC name is azane;propanoic acid;hydrofluoride.
Molecular Properties
| Compound Name | azane;propanoic acid;hydrofluoride |
| PubChem CID | 174943472 |
| Molecular Formula | C3H10FNO2 |
| Molecular Weight | 111.12 g/mol |
| Exact Mass | 111.07 |
| IUPAC Name | azane;propanoic acid;hydrofluoride |
| SMILES | CCC(=O)O.F.N |
| InChI | InChI=1S/C3H6O2.FH.H3N/c1-2-3(4)5;;/h2H2,1H3,(H,4,5);1H;1H3 |
| InChIKey | PPUJBLASQVYIED-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 72.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.12 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azane;propanoic acid;hydrofluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;propanoic acid;hydrofluoride?
The IUPAC name of azane;propanoic acid;hydrofluoride (CID 174943472) is azane;propanoic acid;hydrofluoride.
What is the SMILES notation for azane;propanoic acid;hydrofluoride?
The canonical SMILES for azane;propanoic acid;hydrofluoride is CCC(=O)O.F.N.
What is the InChIKey of azane;propanoic acid;hydrofluoride?
The InChIKey is PPUJBLASQVYIED-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O2.FH.H3N/c1-2-3(4)5;;/h2H2,1H3,(H,4,5);1H;1H3.
What are the key properties of azane;propanoic acid;hydrofluoride?
azane;propanoic acid;hydrofluoride has a molecular weight of 111.12 g/mol, XLogP of 0.80, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;propanoic acid;hydrofluoride is sourced from PubChem (CID 174943472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).