About N-butan-2-ylidenehydroxylamine;vanadium
N-butan-2-ylidenehydroxylamine;vanadium (PubChem CID 162258260) has the molecular formula C4H9NOV
and a molecular weight of 138.07 g/mol. Its IUPAC name is N-butan-2-ylidenehydroxylamine;vanadium.
Molecular Properties
| Compound Name | N-butan-2-ylidenehydroxylamine;vanadium |
| PubChem CID | 162258260 |
| Molecular Formula | C4H9NOV |
| Molecular Weight | 138.07 g/mol |
| Exact Mass | 138.01 |
| IUPAC Name | N-butan-2-ylidenehydroxylamine;vanadium |
| SMILES | CCC(C)=NO.[V] |
| InChI | InChI=1S/C4H9NO.V/c1-3-4(2)5-6;/h6H,3H2,1-2H3; |
| InChIKey | ZYWPPMLYLRULDI-UHFFFAOYSA-N |
| XLogP | 1.24 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 138.07 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-butan-2-ylidenehydroxylamine;vanadium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-butan-2-ylidenehydroxylamine;vanadium?
The IUPAC name of N-butan-2-ylidenehydroxylamine;vanadium (CID 162258260) is N-butan-2-ylidenehydroxylamine;vanadium.
What is the SMILES notation for N-butan-2-ylidenehydroxylamine;vanadium?
The canonical SMILES for N-butan-2-ylidenehydroxylamine;vanadium is CCC(C)=NO.[V].
What is the InChIKey of N-butan-2-ylidenehydroxylamine;vanadium?
The InChIKey is ZYWPPMLYLRULDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO.V/c1-3-4(2)5-6;/h6H,3H2,1-2H3;.
What are the key properties of N-butan-2-ylidenehydroxylamine;vanadium?
N-butan-2-ylidenehydroxylamine;vanadium has a molecular weight of 138.07 g/mol, XLogP of 1.24, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-butan-2-ylidenehydroxylamine;vanadium is sourced from PubChem (CID 162258260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).