About ethylaluminum(2+);phosphenic acid
ethylaluminum(2+);phosphenic acid (PubChem CID 158590735) has the molecular formula C2H7AlO6P2+2
and a molecular weight of 216.00 g/mol. Its IUPAC name is ethylaluminum(2+);phosphenic acid.
Molecular Properties
| Compound Name | ethylaluminum(2+);phosphenic acid |
| PubChem CID | 158590735 |
| Molecular Formula | C2H7AlO6P2+2 |
| Molecular Weight | 216.00 g/mol |
| Exact Mass | 215.95 |
| IUPAC Name | ethylaluminum(2+);phosphenic acid |
| SMILES | CC[Al+2].O=[P+]([O-])O.O=[P+]([O-])O |
| InChI | InChI=1S/C2H5.Al.2HO3P/c1-2;;2*1-4(2)3/h1H2,2H3;;2*(H,1,2,3)/q;+2;; |
| InChIKey | PEFZXJSWVHAQHZ-UHFFFAOYSA-N |
| XLogP | -1.41 |
| TPSA | 120.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.00 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethylaluminum(2+);phosphenic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethylaluminum(2+);phosphenic acid?
The IUPAC name of ethylaluminum(2+);phosphenic acid (CID 158590735) is ethylaluminum(2+);phosphenic acid.
What is the SMILES notation for ethylaluminum(2+);phosphenic acid?
The canonical SMILES for ethylaluminum(2+);phosphenic acid is CC[Al+2].O=[P+]([O-])O.O=[P+]([O-])O.
What is the InChIKey of ethylaluminum(2+);phosphenic acid?
The InChIKey is PEFZXJSWVHAQHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H5.Al.2HO3P/c1-2;;2*1-4(2)3/h1H2,2H3;;2*(H,1,2,3)/q;+2;;.
What are the key properties of ethylaluminum(2+);phosphenic acid?
ethylaluminum(2+);phosphenic acid has a molecular weight of 216.00 g/mol, XLogP of -1.41, 0 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethylaluminum(2+);phosphenic acid is sourced from PubChem (CID 158590735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).