About calcium;ethyl-hydroxy-oxophosphanium;hydride
calcium;ethyl-hydroxy-oxophosphanium;hydride (PubChem CID 174736026) has the molecular formula C2H8CaO2P+
and a molecular weight of 135.14 g/mol. Its IUPAC name is calcium;ethyl-hydroxy-oxophosphanium;hydride.
Molecular Properties
| Compound Name | calcium;ethyl-hydroxy-oxophosphanium;hydride |
| PubChem CID | 174736026 |
| Molecular Formula | C2H8CaO2P+ |
| Molecular Weight | 135.14 g/mol |
| Exact Mass | 134.99 |
| IUPAC Name | calcium;ethyl-hydroxy-oxophosphanium;hydride |
| SMILES | CC[P+](=O)O.[Ca+2].[H-].[H-] |
| InChI | InChI=1S/C2H5O2P.Ca.2H/c1-2-5(3)4;;;/h2H2,1H3;;;/q;+2;2*-1/p+1 |
| InChIKey | JLZLXLPNOPKIFX-UHFFFAOYSA-O |
| XLogP | 0.59 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.14 |
| LogP ≤ 5 | 0.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze calcium;ethyl-hydroxy-oxophosphanium;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of calcium;ethyl-hydroxy-oxophosphanium;hydride?
The IUPAC name of calcium;ethyl-hydroxy-oxophosphanium;hydride (CID 174736026) is calcium;ethyl-hydroxy-oxophosphanium;hydride.
What is the SMILES notation for calcium;ethyl-hydroxy-oxophosphanium;hydride?
The canonical SMILES for calcium;ethyl-hydroxy-oxophosphanium;hydride is CC[P+](=O)O.[Ca+2].[H-].[H-].
What is the InChIKey of calcium;ethyl-hydroxy-oxophosphanium;hydride?
The InChIKey is JLZLXLPNOPKIFX-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H5O2P.Ca.2H/c1-2-5(3)4;;;/h2H2,1H3;;;/q;+2;2*-1/p+1.
What are the key properties of calcium;ethyl-hydroxy-oxophosphanium;hydride?
calcium;ethyl-hydroxy-oxophosphanium;hydride has a molecular weight of 135.14 g/mol, XLogP of 0.59, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for calcium;ethyl-hydroxy-oxophosphanium;hydride is sourced from PubChem (CID 174736026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).