dimethylaminoazanium;phosphenic acid

C2H10N2O3P+ — CID 139088119

IUPACdimethylaminoazanium;phosphenic acid
SMILESCN(C)[NH3+].O=[P+]([O-])O
InChIInChI=1S/C2H8N2.HO3P/c2*1-4(2)3/h3H2,1-2H3;(H,1,2,3)/p+1
InChIKeyZYUHFQGKMYROKU-UHFFFAOYSA-O
MW141.09 g/mol
LogP-2.30
Rot. Bonds

About dimethylaminoazanium;phosphenic acid

dimethylaminoazanium;phosphenic acid (PubChem CID 139088119) has the molecular formula C2H10N2O3P+ and a molecular weight of 141.09 g/mol. Its IUPAC name is dimethylaminoazanium;phosphenic acid.

Molecular Properties

Compound Namedimethylaminoazanium;phosphenic acid
PubChem CID139088119
Molecular FormulaC2H10N2O3P+
Molecular Weight141.09 g/mol
Exact Mass141.04
IUPAC Namedimethylaminoazanium;phosphenic acid
SMILESCN(C)[NH3+].O=[P+]([O-])O
InChIInChI=1S/C2H8N2.HO3P/c2*1-4(2)3/h3H2,1-2H3;(H,1,2,3)/p+1
InChIKeyZYUHFQGKMYROKU-UHFFFAOYSA-O
XLogP-2.30
TPSA91.24 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds
Heavy Atoms8
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500141.09
LogP ≤ 5-2.30
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}

Analyze dimethylaminoazanium;phosphenic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of dimethylaminoazanium;phosphenic acid?
The IUPAC name of dimethylaminoazanium;phosphenic acid (CID 139088119) is dimethylaminoazanium;phosphenic acid.
What is the SMILES notation for dimethylaminoazanium;phosphenic acid?
The canonical SMILES for dimethylaminoazanium;phosphenic acid is CN(C)[NH3+].O=[P+]([O-])O.
What is the InChIKey of dimethylaminoazanium;phosphenic acid?
The InChIKey is ZYUHFQGKMYROKU-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H8N2.HO3P/c2*1-4(2)3/h3H2,1-2H3;(H,1,2,3)/p+1.
What are the key properties of dimethylaminoazanium;phosphenic acid?
dimethylaminoazanium;phosphenic acid has a molecular weight of 141.09 g/mol, XLogP of -2.30, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylaminoazanium;phosphenic acid is sourced from PubChem (CID 139088119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).