About dimethylaminoazanium;phosphenic acid
dimethylaminoazanium;phosphenic acid (PubChem CID 139088119) has the molecular formula C2H10N2O3P+
and a molecular weight of 141.09 g/mol. Its IUPAC name is dimethylaminoazanium;phosphenic acid.
Molecular Properties
| Compound Name | dimethylaminoazanium;phosphenic acid |
| PubChem CID | 139088119 |
| Molecular Formula | C2H10N2O3P+ |
| Molecular Weight | 141.09 g/mol |
| Exact Mass | 141.04 |
| IUPAC Name | dimethylaminoazanium;phosphenic acid |
| SMILES | CN(C)[NH3+].O=[P+]([O-])O |
| InChI | InChI=1S/C2H8N2.HO3P/c2*1-4(2)3/h3H2,1-2H3;(H,1,2,3)/p+1 |
| InChIKey | ZYUHFQGKMYROKU-UHFFFAOYSA-O |
| XLogP | -2.30 |
| TPSA | 91.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.09 |
| LogP ≤ 5 | -2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dimethylaminoazanium;phosphenic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dimethylaminoazanium;phosphenic acid?
The IUPAC name of dimethylaminoazanium;phosphenic acid (CID 139088119) is dimethylaminoazanium;phosphenic acid.
What is the SMILES notation for dimethylaminoazanium;phosphenic acid?
The canonical SMILES for dimethylaminoazanium;phosphenic acid is CN(C)[NH3+].O=[P+]([O-])O.
What is the InChIKey of dimethylaminoazanium;phosphenic acid?
The InChIKey is ZYUHFQGKMYROKU-UHFFFAOYSA-O. The full InChI is InChI=1S/C2H8N2.HO3P/c2*1-4(2)3/h3H2,1-2H3;(H,1,2,3)/p+1.
What are the key properties of dimethylaminoazanium;phosphenic acid?
dimethylaminoazanium;phosphenic acid has a molecular weight of 141.09 g/mol, XLogP of -2.30, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for dimethylaminoazanium;phosphenic acid is sourced from PubChem (CID 139088119), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).