C5H15N3O3P+ — CID 110187264
dihydroxy(oxo)phosphanium;1,1,3,3-tetramethylguanidine (PubChem CID 110187264) has the molecular formula C5H15N3O3P+ and a molecular weight of 196.17 g/mol. Its IUPAC name is dihydroxy(oxo)phosphanium;1,1,3,3-tetramethylguanidine.
| Compound Name | dihydroxy(oxo)phosphanium;1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 110187264 |
| Molecular Formula | C5H15N3O3P+ |
| Molecular Weight | 196.17 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | dihydroxy(oxo)phosphanium;1,1,3,3-tetramethylguanidine |
| SMILES | O=[P+](O)O.[H]N=C(N(C)C)N(C)C |
| InChI | InChI=1S/C5H13N3.HO3P/c1-7(2)5(6)8(3)4;1-4(2)3/h6H,1-4H3;(H-,1,2,3)/p+1 |
| InChIKey | CAUKOXVWJLASJF-UHFFFAOYSA-O |
| XLogP | -0.33 |
| TPSA | 87.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.17 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|