C5H13N6- — CID 131724047
1,1,3,3-tetramethylguanidine azide (PubChem CID 131724047) has the molecular formula C5H13N6- and a molecular weight of 157.20 g/mol. Its IUPAC name is 1,1,3,3-tetramethylguanidine azide.
| Compound Name | 1,1,3,3-tetramethylguanidine azide |
|---|---|
| PubChem CID | 131724047 |
| Molecular Formula | C5H13N6- |
| Molecular Weight | 157.20 g/mol |
| Exact Mass | 157.12 |
| IUPAC Name | 1,1,3,3-tetramethylguanidine azide |
| SMILES | [H]N=C(N(C)C)N(C)C.[N-]=[N+]=[N-] |
| InChI | InChI=1S/C5H13N3.N3/c1-7(2)5(6)8(3)4;1-3-2/h6H,1-4H3;/q;-1 |
| InChIKey | ZMMRLWFGWQVVJD-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.20 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|