C20H43N3O2 — CID 87629071
pentadecanoic acid;1,1,3,3-tetramethylguanidine (PubChem CID 87629071) has the molecular formula C20H43N3O2 and a molecular weight of 357.58 g/mol. Its IUPAC name is pentadecanoic acid;1,1,3,3-tetramethylguanidine.
| Compound Name | pentadecanoic acid;1,1,3,3-tetramethylguanidine |
|---|---|
| PubChem CID | 87629071 |
| Molecular Formula | C20H43N3O2 |
| Molecular Weight | 357.58 g/mol |
| Exact Mass | 357.34 |
| IUPAC Name | pentadecanoic acid;1,1,3,3-tetramethylguanidine |
| SMILES | CCCCCCCCCCCCCCC(=O)O.[H]N=C(N(C)C)N(C)C |
| InChI | InChI=1S/C15H30O2.C5H13N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17;1-7(2)5(6)8(3)4/h2-14H2,1H3,(H,16,17);6H,1-4H3 |
| InChIKey | XZMONWFQFSLVDA-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 67.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.58 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|