About gallium;N,N-diethylethanamine;triazide
gallium;N,N-diethylethanamine;triazide (PubChem CID 11808618) has the molecular formula C6H15GaN10
and a molecular weight of 296.98 g/mol. Its IUPAC name is gallium;N,N-diethylethanamine;triazide.
Molecular Properties
| Compound Name | gallium;N,N-diethylethanamine;triazide |
| PubChem CID | 11808618 |
| Molecular Formula | C6H15GaN10 |
| Molecular Weight | 296.98 g/mol |
| Exact Mass | 296.07 |
| IUPAC Name | gallium;N,N-diethylethanamine;triazide |
| SMILES | CCN(CC)CC.[Ga+3].[N-]=[N+]=[N-].[N-]=[N+]=[N-].[N-]=[N+]=[N-] |
| InChI | InChI=1S/C6H15N.Ga.3N3/c1-4-7(5-2)6-3;;3*1-3-2/h4-6H2,1-3H3;;;;/q;+3;3*-1 |
| InChIKey | PWJLNGHZXYYPSD-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 179.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.98 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze gallium;N,N-diethylethanamine;triazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of gallium;N,N-diethylethanamine;triazide?
The IUPAC name of gallium;N,N-diethylethanamine;triazide (CID 11808618) is gallium;N,N-diethylethanamine;triazide.
What is the SMILES notation for gallium;N,N-diethylethanamine;triazide?
The canonical SMILES for gallium;N,N-diethylethanamine;triazide is CCN(CC)CC.[Ga+3].[N-]=[N+]=[N-].[N-]=[N+]=[N-].[N-]=[N+]=[N-].
What is the InChIKey of gallium;N,N-diethylethanamine;triazide?
The InChIKey is PWJLNGHZXYYPSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15N.Ga.3N3/c1-4-7(5-2)6-3;;3*1-3-2/h4-6H2,1-3H3;;;;/q;+3;3*-1.
What are the key properties of gallium;N,N-diethylethanamine;triazide?
gallium;N,N-diethylethanamine;triazide has a molecular weight of 296.98 g/mol, XLogP of 3.57, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for gallium;N,N-diethylethanamine;triazide is sourced from PubChem (CID 11808618), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).