C23H38O — CID 158610182
2,3,3a,4,5,6,7,7a-octahydro-1H-indene;bicyclo[4.2.0]octane;cyclohex-3-en-1-one (PubChem CID 158610182) has the molecular formula C23H38O and a molecular weight of 330.56 g/mol. Its IUPAC name is 2,3,3a,4,5,6,7,7a-octahydro-1H-indene;bicyclo[4.2.0]octane;cyclohex-3-en-1-one.
| Compound Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indene;bicyclo[4.2.0]octane;cyclohex-3-en-1-one |
|---|---|
| PubChem CID | 158610182 |
| Molecular Formula | C23H38O |
| Molecular Weight | 330.56 g/mol |
| Exact Mass | 330.29 |
| IUPAC Name | 2,3,3a,4,5,6,7,7a-octahydro-1H-indene;bicyclo[4.2.0]octane;cyclohex-3-en-1-one |
| SMILES | C1CCC2CCC2C1.C1CCC2CCCC2C1.O=C1CC=CCC1 |
| InChI | InChI=1S/C9H16.C8H14.C6H8O/c1-2-5-9-7-3-6-8(9)4-1;1-2-4-8-6-5-7(8)3-1;7-6-4-2-1-3-5-6/h8-9H,1-7H2;7-8H,1-6H2;1-2H,3-5H2 |
| InChIKey | HWSWYHOHBCWOJN-UHFFFAOYSA-N |
| XLogP | 6.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.56 |
| LogP ≤ 5 | 6.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|