About N-(4-methylidenearsanylnaphthalen-1-yl)acetamide
N-(4-methylidenearsanylnaphthalen-1-yl)acetamide (PubChem CID 158613942) has the molecular formula C13H12AsNO
and a molecular weight of 273.17 g/mol. Its IUPAC name is N-(4-methylidenearsanylnaphthalen-1-yl)acetamide.
Molecular Properties
| Compound Name | N-(4-methylidenearsanylnaphthalen-1-yl)acetamide |
| PubChem CID | 158613942 |
| Molecular Formula | C13H12AsNO |
| Molecular Weight | 273.17 g/mol |
| Exact Mass | 273.01 |
| IUPAC Name | N-(4-methylidenearsanylnaphthalen-1-yl)acetamide |
| SMILES | C=[As]c1ccc(NC(C)=O)c2ccccc12 |
| InChI | InChI=1S/C13H12AsNO/c1-9(16)15-13-8-7-12(14-2)10-5-3-4-6-11(10)13/h3-8H,2H2,1H3,(H,15,16) |
| InChIKey | HWSAYAQZZPGRFR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.17 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-(4-methylidenearsanylnaphthalen-1-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-methylidenearsanylnaphthalen-1-yl)acetamide?
The IUPAC name of N-(4-methylidenearsanylnaphthalen-1-yl)acetamide (CID 158613942) is N-(4-methylidenearsanylnaphthalen-1-yl)acetamide.
What is the SMILES notation for N-(4-methylidenearsanylnaphthalen-1-yl)acetamide?
The canonical SMILES for N-(4-methylidenearsanylnaphthalen-1-yl)acetamide is C=[As]c1ccc(NC(C)=O)c2ccccc12.
What is the InChIKey of N-(4-methylidenearsanylnaphthalen-1-yl)acetamide?
The InChIKey is HWSAYAQZZPGRFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12AsNO/c1-9(16)15-13-8-7-12(14-2)10-5-3-4-6-11(10)13/h3-8H,2H2,1H3,(H,15,16).
What are the key properties of N-(4-methylidenearsanylnaphthalen-1-yl)acetamide?
N-(4-methylidenearsanylnaphthalen-1-yl)acetamide has a molecular weight of 273.17 g/mol, XLogP of 1.56, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-methylidenearsanylnaphthalen-1-yl)acetamide is sourced from PubChem (CID 158613942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).