C48H70N4O4 — CID 158614415
N-[5-[2-hydroxy-4-oxo-3-(2,3,3-trimethyl-6-octanoylimino-1-propan-2-yl-2H-indol-5-ylidene)cyclobuten-1-yl]-2,3,3-trimethyl-1-propan-2-yl-2H-indol-6-yl]octanamide (PubChem CID 158614415) has the molecular formula C48H70N4O4 and a molecular weight of 767.11 g/mol. Its IUPAC name is N-[5-[2-hydroxy-4-oxo-3-(2,3,3-trimethyl-6-octanoylimino-1-propan-2-yl-2H-indol-5-ylidene)cyclobuten-1-yl]-2,3,3-trimethyl-1-propan-2-yl-2H-indol-6-yl]octanamide.
| Compound Name | N-[5-[2-hydroxy-4-oxo-3-(2,3,3-trimethyl-6-octanoylimino-1-propan-2-yl-2H-indol-5-ylidene)cyclobuten-1-yl]-2,3,3-trimethyl-1-propan-2-yl-2H-indol-6-yl]octanamide |
|---|---|
| PubChem CID | 158614415 |
| Molecular Formula | C48H70N4O4 |
| Molecular Weight | 767.11 g/mol |
| Exact Mass | 766.54 |
| IUPAC Name | N-[5-[2-hydroxy-4-oxo-3-(2,3,3-trimethyl-6-octanoylimino-1-propan-2-yl-2H-indol-5-ylidene)cyclobuten-1-yl]-2,3,3-trimethyl-1-propan-2-yl-2H-indol-6-yl]octanamide |
| SMILES | CCCCCCCC(=O)/N=C1\C=C2C(=CC1=C1C(=O)C(c3cc4c(cc3NC(=O)CCCCCCC)N(C(C)C)C(C)C4(C)C)=C1O)C(C)(C)C(C)N2C(C)C |
| InChI | InChI=1S/C48H70N4O4/c1-13-15-17-19-21-23-41(53)49-37-27-39-35(47(9,10)31(7)51(39)29(3)4)25-33(37)43-45(55)44(46(43)56)34-26-36-40(52(30(5)6)32(8)48(36,11)12)28-38(34)50-42(54)24-22-20-18-16-14-2/h25-32,55H,13-24H2,1-12H3,(H,49,53)/b44-34?,50-38+ |
| InChIKey | PWZXJQFSBQVFFT-UCXDQHBDSA-N |
| XLogP | 11.32 |
| TPSA | 102.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 767.11 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|