About methane;2-methylpropane;1,3-oxazolidine-2-thione
methane;2-methylpropane;1,3-oxazolidine-2-thione (PubChem CID 158615181) has the molecular formula C8H19NOS
and a molecular weight of 177.31 g/mol. Its IUPAC name is methane;2-methylpropane;1,3-oxazolidine-2-thione.
Molecular Properties
| Compound Name | methane;2-methylpropane;1,3-oxazolidine-2-thione |
| PubChem CID | 158615181 |
| Molecular Formula | C8H19NOS |
| Molecular Weight | 177.31 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | methane;2-methylpropane;1,3-oxazolidine-2-thione |
| SMILES | C.CC(C)C.S=C1NCCO1 |
| InChI | InChI=1S/C4H10.C3H5NOS.CH4/c1-4(2)3;6-3-4-1-2-5-3;/h4H,1-3H3;1-2H2,(H,4,6);1H4 |
| InChIKey | HXHMINQLTBLKEP-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.31 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze methane;2-methylpropane;1,3-oxazolidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;2-methylpropane;1,3-oxazolidine-2-thione?
The IUPAC name of methane;2-methylpropane;1,3-oxazolidine-2-thione (CID 158615181) is methane;2-methylpropane;1,3-oxazolidine-2-thione.
What is the SMILES notation for methane;2-methylpropane;1,3-oxazolidine-2-thione?
The canonical SMILES for methane;2-methylpropane;1,3-oxazolidine-2-thione is C.CC(C)C.S=C1NCCO1.
What is the InChIKey of methane;2-methylpropane;1,3-oxazolidine-2-thione?
The InChIKey is HXHMINQLTBLKEP-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.C3H5NOS.CH4/c1-4(2)3;6-3-4-1-2-5-3;/h4H,1-3H3;1-2H2,(H,4,6);1H4.
What are the key properties of methane;2-methylpropane;1,3-oxazolidine-2-thione?
methane;2-methylpropane;1,3-oxazolidine-2-thione has a molecular weight of 177.31 g/mol, XLogP of 2.19, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;2-methylpropane;1,3-oxazolidine-2-thione is sourced from PubChem (CID 158615181), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).