C8H19NOS — CID 54167321
ethane;4-methyl-1,3-oxazolidine-2-thione (PubChem CID 54167321) has the molecular formula C8H19NOS and a molecular weight of 177.31 g/mol. Its IUPAC name is ethane;4-methyl-1,3-oxazolidine-2-thione.
| Compound Name | ethane;4-methyl-1,3-oxazolidine-2-thione |
|---|---|
| PubChem CID | 54167321 |
| Molecular Formula | C8H19NOS |
| Molecular Weight | 177.31 g/mol |
| Exact Mass | 177.12 |
| IUPAC Name | ethane;4-methyl-1,3-oxazolidine-2-thione |
| SMILES | CC.CC.CC1COC(=S)N1 |
| InChI | InChI=1S/C4H7NOS.2C2H6/c1-3-2-6-4(7)5-3;2*1-2/h3H,2H2,1H3,(H,5,7);2*1-2H3 |
| InChIKey | OSOFWDBNLOMRJU-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|