C8H9NW3Y-2 — CID 158619548
3-methanidyl-5,6-dimethyl-2H-pyridin-2-ide;tungsten;yttrium (PubChem CID 158619548) has the molecular formula C8H9NW3Y-2 and a molecular weight of 759.59 g/mol. Its IUPAC name is 3-methanidyl-5,6-dimethyl-2H-pyridin-2-ide;tungsten;yttrium.
| Compound Name | 3-methanidyl-5,6-dimethyl-2H-pyridin-2-ide;tungsten;yttrium |
|---|---|
| PubChem CID | 158619548 |
| Molecular Formula | C8H9NW3Y-2 |
| Molecular Weight | 759.59 g/mol |
| Exact Mass | 759.83 |
| IUPAC Name | 3-methanidyl-5,6-dimethyl-2H-pyridin-2-ide;tungsten;yttrium |
| SMILES | [CH2-]c1[c-]nc(C)c(C)c1.[W].[W].[W].[Y] |
| InChI | InChI=1S/C8H9N.3W.Y/c1-6-4-7(2)8(3)9-5-6;;;;/h4H,1H2,2-3H3;;;;/q-2;;;; |
| InChIKey | RJDATXYTOUEGGM-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.59 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|