C30H52N2O7 — CID 158622781
dihexyl (2R)-2-[(3S)-3-methyl-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]imidazol-2-yl]-2-oxobutyl]butanedioate;methane (PubChem CID 158622781) has the molecular formula C30H52N2O7 and a molecular weight of 552.75 g/mol. Its IUPAC name is dihexyl (2R)-2-[(3S)-3-methyl-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]imidazol-2-yl]-2-oxobutyl]butanedioate;methane.
| Compound Name | dihexyl (2R)-2-[(3S)-3-methyl-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]imidazol-2-yl]-2-oxobutyl]butanedioate;methane |
|---|---|
| PubChem CID | 158622781 |
| Molecular Formula | C30H52N2O7 |
| Molecular Weight | 552.75 g/mol |
| Exact Mass | 552.38 |
| IUPAC Name | dihexyl (2R)-2-[(3S)-3-methyl-4-[1-[(2-methylpropan-2-yl)oxycarbonyl]imidazol-2-yl]-2-oxobutyl]butanedioate;methane |
| SMILES | C.CCCCCCOC(=O)C[C@@H](CC(=O)[C@@H](C)Cc1nccn1C(=O)OC(C)(C)C)C(=O)OCCCCCC |
| InChI | InChI=1S/C29H48N2O7.CH4/c1-7-9-11-13-17-36-26(33)21-23(27(34)37-18-14-12-10-8-2)20-24(32)22(3)19-25-30-15-16-31(25)28(35)38-29(4,5)6;/h15-16,22-23H,7-14,17-21H2,1-6H3;1H4/t22-,23+;/m0./s1 |
| InChIKey | HYFCKHOWZSFVOD-PEADMDKFSA-N |
| XLogP | 6.69 |
| TPSA | 113.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.75 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|