C18H27NO7 — CID 158624452
3-amino-2-(1-deuterio-2-methylpropan-2-yl)oxycarbonylbutanoic acid;3-(4-hydroxyphenyl)propanoic acid (PubChem CID 158624452) has the molecular formula C18H27NO7 and a molecular weight of 370.42 g/mol. Its IUPAC name is 3-amino-2-(1-deuterio-2-methylpropan-2-yl)oxycarbonylbutanoic acid;3-(4-hydroxyphenyl)propanoic acid.
| Compound Name | 3-amino-2-(1-deuterio-2-methylpropan-2-yl)oxycarbonylbutanoic acid;3-(4-hydroxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 158624452 |
| Molecular Formula | C18H27NO7 |
| Molecular Weight | 370.42 g/mol |
| Exact Mass | 370.19 |
| IUPAC Name | 3-amino-2-(1-deuterio-2-methylpropan-2-yl)oxycarbonylbutanoic acid;3-(4-hydroxyphenyl)propanoic acid |
| SMILES | O=C(O)CCc1ccc(O)cc1.[2H]CC(C)(C)OC(=O)C(C(=O)O)C(C)N |
| InChI | InChI=1S/C9H17NO4.C9H10O3/c1-5(10)6(7(11)12)8(13)14-9(2,3)4;10-8-4-1-7(2-5-8)3-6-9(11)12/h5-6H,10H2,1-4H3,(H,11,12);1-2,4-5,10H,3,6H2,(H,11,12)/i2D; |
| InChIKey | HYKKKGVHSRGMIO-YPAXDSTQSA-N |
| XLogP | 1.79 |
| TPSA | 147.15 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.42 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|