C22H20FN4O6PS — CID 158625101
2-[5-amino-6-[2-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]acetyl]pyrazin-2-yl]-4-fluorobenzonitrile (PubChem CID 158625101) has the molecular formula C22H20FN4O6PS and a molecular weight of 518.46 g/mol. Its IUPAC name is 2-[5-amino-6-[2-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]acetyl]pyrazin-2-yl]-4-fluorobenzonitrile.
| Compound Name | 2-[5-amino-6-[2-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]acetyl]pyrazin-2-yl]-4-fluorobenzonitrile |
|---|---|
| PubChem CID | 158625101 |
| Molecular Formula | C22H20FN4O6PS |
| Molecular Weight | 518.46 g/mol |
| Exact Mass | 518.08 |
| IUPAC Name | 2-[5-amino-6-[2-[4-(dimethoxyphosphorylmethylsulfonyl)phenyl]acetyl]pyrazin-2-yl]-4-fluorobenzonitrile |
| SMILES | COP(=O)(CS(=O)(=O)c1ccc(CC(=O)c2nc(-c3cc(F)ccc3C#N)cnc2N)cc1)OC |
| InChI | InChI=1S/C22H20FN4O6PS/c1-32-34(29,33-2)13-35(30,31)17-7-3-14(4-8-17)9-20(28)21-22(25)26-12-19(27-21)18-10-16(23)6-5-15(18)11-24/h3-8,10,12H,9,13H2,1-2H3,(H2,25,26) |
| InChIKey | NWPIOVZTJIYNQE-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 162.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.46 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|