C31H39Cl3N2O5 — CID 158626904
2-acetyl-5-[[4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-methylamino]-3-(2,3-dichlorophenyl)-4-methylpent-2-enoic acid;hydrochloride (PubChem CID 158626904) has the molecular formula C31H39Cl3N2O5 and a molecular weight of 626.02 g/mol. Its IUPAC name is 2-acetyl-5-[[4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-methylamino]-3-(2,3-dichlorophenyl)-4-methylpent-2-enoic acid;hydrochloride.
| Compound Name | 2-acetyl-5-[[4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-methylamino]-3-(2,3-dichlorophenyl)-4-methylpent-2-enoic acid;hydrochloride |
|---|---|
| PubChem CID | 158626904 |
| Molecular Formula | C31H39Cl3N2O5 |
| Molecular Weight | 626.02 g/mol |
| Exact Mass | 624.19 |
| IUPAC Name | 2-acetyl-5-[[4-cyano-4-(3,4-dimethoxyphenyl)-5-methylhexyl]-methylamino]-3-(2,3-dichlorophenyl)-4-methylpent-2-enoic acid;hydrochloride |
| SMILES | COc1ccc(C(C#N)(CCCN(C)CC(C)C(=C(C(C)=O)C(=O)O)c2cccc(Cl)c2Cl)C(C)C)cc1OC.Cl |
| InChI | InChI=1S/C31H38Cl2N2O5.ClH/c1-19(2)31(18-34,22-12-13-25(39-6)26(16-22)40-7)14-9-15-35(5)17-20(3)27(28(21(4)36)30(37)38)23-10-8-11-24(32)29(23)33;/h8,10-13,16,19-20H,9,14-15,17H2,1-7H3,(H,37,38);1H |
| InChIKey | JKWDOYDPBRAZPZ-UHFFFAOYSA-N |
| XLogP | 7.33 |
| TPSA | 99.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.02 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|