C22H24O7 — CID 158627858
(2-ethoxy-1,3-benzodioxol-4-yl) 4-(2,2-dimethylbutanoyloxy)benzoate (PubChem CID 158627858) has the molecular formula C22H24O7 and a molecular weight of 400.43 g/mol. Its IUPAC name is (2-ethoxy-1,3-benzodioxol-4-yl) 4-(2,2-dimethylbutanoyloxy)benzoate.
| Compound Name | (2-ethoxy-1,3-benzodioxol-4-yl) 4-(2,2-dimethylbutanoyloxy)benzoate |
|---|---|
| PubChem CID | 158627858 |
| Molecular Formula | C22H24O7 |
| Molecular Weight | 400.43 g/mol |
| Exact Mass | 400.15 |
| IUPAC Name | (2-ethoxy-1,3-benzodioxol-4-yl) 4-(2,2-dimethylbutanoyloxy)benzoate |
| SMILES | CCOC1Oc2cccc(OC(=O)c3ccc(OC(=O)C(C)(C)CC)cc3)c2O1 |
| InChI | InChI=1S/C22H24O7/c1-5-22(3,4)20(24)26-15-12-10-14(11-13-15)19(23)27-16-8-7-9-17-18(16)29-21(28-17)25-6-2/h7-13,21H,5-6H2,1-4H3 |
| InChIKey | GCGXUGDVBAHRHR-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.43 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|